![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size |
|---|---|---|---|
| Parent Directory | - | |
| Construction Materials 2_StrEng MSc_MSM082AN.doc | 2017-09-06 12:55 | 61K |
| Diagnostics and Analysis of Structures_StrEng MSc_MSM410AN.doc | 2017-09-12 18:16 | 62K |
| MSM407AN_Structural Otimization.pdf | 2018-02-06 08:31 | 279K |
| PMTATNM064OA_Interaction between Soil and Structure.doc | 2017-09-11 08:28 | 61K |
| Rehabilitation of Structures_StrEng MSc_MSM408AN.doc | 2017-09-12 18:10 | 63K |
| Syllabus_2017_Numerical_Methods_for Civil_Engineering.pdf | 2017-09-06 07:22 | 285K |
| Syllabus_2017_Structures_1.pdf | 2017-09-06 07:16 | 289K |
| syllabus_2017_Maths for structural engineers MSc.pdf | 2017-10-16 07:57 | 162K |